C20H28O3 — CID 130467368
(1E,4S,10Z,13S)-4-pentyl-5-oxabicyclo[11.3.0]hexadeca-1,10,14-triene-6,16-dione (PubChem CID 130467368) has the molecular formula C20H28O3 and a molecular weight of 316.44 g/mol. Its IUPAC name is (1E,4S,10Z,13S)-4-pentyl-5-oxabicyclo[11.3.0]hexadeca-1,10,14-triene-6,16-dione.
| Compound Name | (1E,4S,10Z,13S)-4-pentyl-5-oxabicyclo[11.3.0]hexadeca-1,10,14-triene-6,16-dione |
|---|---|
| PubChem CID | 130467368 |
| Molecular Formula | C20H28O3 |
| Molecular Weight | 316.44 g/mol |
| Exact Mass | 316.20 |
| IUPAC Name | (1E,4S,10Z,13S)-4-pentyl-5-oxabicyclo[11.3.0]hexadeca-1,10,14-triene-6,16-dione |
| SMILES | CCCCC[C@H]1C/C=C2/C(=O)C=C[C@@H]2C/C=C\CCCC(=O)O1 |
| InChI | InChI=1S/C20H28O3/c1-2-3-6-10-17-13-14-18-16(12-15-19(18)21)9-7-4-5-8-11-20(22)23-17/h4,7,12,14-17H,2-3,5-6,8-11,13H2,1H3/b7-4-,18-14+/t16-,17-/m0/s1 |
| InChIKey | VGVVHQXKYSPTSU-GJGHEGAFSA-N |
| XLogP | 4.68 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 316.44 |
| LogP ≤ 5 | 4.68 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|