C13H23NO2 — CID 130467443
(3S)-2-[(2E,4E)-5-hydroxy-2-methylpenta-2,4-dienyl]-1,3-dimethylpiperidin-3-ol (PubChem CID 130467443) has the molecular formula C13H23NO2 and a molecular weight of 225.33 g/mol. Its IUPAC name is (3S)-2-[(2E,4E)-5-hydroxy-2-methylpenta-2,4-dienyl]-1,3-dimethylpiperidin-3-ol.
| Compound Name | (3S)-2-[(2E,4E)-5-hydroxy-2-methylpenta-2,4-dienyl]-1,3-dimethylpiperidin-3-ol |
|---|---|
| PubChem CID | 130467443 |
| Molecular Formula | C13H23NO2 |
| Molecular Weight | 225.33 g/mol |
| Exact Mass | 225.17 |
| IUPAC Name | (3S)-2-[(2E,4E)-5-hydroxy-2-methylpenta-2,4-dienyl]-1,3-dimethylpiperidin-3-ol |
| SMILES | C/C(=C\C=C\O)CC1N(C)CCC[C@]1(C)O |
| InChI | InChI=1S/C13H23NO2/c1-11(6-4-9-15)10-12-13(2,16)7-5-8-14(12)3/h4,6,9,12,15-16H,5,7-8,10H2,1-3H3/b9-4+,11-6+/t12?,13-/m0/s1 |
| InChIKey | RCVZJFJODIZQOM-JQILCSBZSA-N |
| XLogP | 2.24 |
| TPSA | 43.70 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 225.33 |
| LogP ≤ 5 | 2.24 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|