About N-[3,7-dimethyl-8-(methylideneamino)-10-phenylphenazin-10-ium-2-yl]prop-2-en-1-imine
N-[3,7-dimethyl-8-(methylideneamino)-10-phenylphenazin-10-ium-2-yl]prop-2-en-1-imine (PubChem CID 130467467) has the molecular formula C24H21N4+
and a molecular weight of 365.46 g/mol. Its IUPAC name is N-[3,7-dimethyl-8-(methylideneamino)-10-phenylphenazin-10-ium-2-yl]prop-2-en-1-imine.
Molecular Properties
| Compound Name | N-[3,7-dimethyl-8-(methylideneamino)-10-phenylphenazin-10-ium-2-yl]prop-2-en-1-imine |
| PubChem CID | 130467467 |
| Molecular Formula | C24H21N4+ |
| Molecular Weight | 365.46 g/mol |
| Exact Mass | 365.18 |
| IUPAC Name | N-[3,7-dimethyl-8-(methylideneamino)-10-phenylphenazin-10-ium-2-yl]prop-2-en-1-imine |
| SMILES | C=C/C=N/c1cc2c(cc1C)nc1cc(C)c(N=C)cc1[n+]2-c1ccccc1 |
| InChI | InChI=1S/C24H21N4/c1-5-11-26-20-15-24-22(13-17(20)3)27-21-12-16(2)19(25-4)14-23(21)28(24)18-9-7-6-8-10-18/h5-15H,1,4H2,2-3H3/q+1 |
| InChIKey | KNJBVMUEHFCZII-UHFFFAOYSA-N |
| XLogP | 5.50 |
| TPSA | 41.49 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 365.46 |
| LogP ≤ 5 | 5.50 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|
Analyze N-[3,7-dimethyl-8-(methylideneamino)-10-phenylphenazin-10-ium-2-yl]prop-2-en-1-imine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-[3,7-dimethyl-8-(methylideneamino)-10-phenylphenazin-10-ium-2-yl]prop-2-en-1-imine?
The IUPAC name of N-[3,7-dimethyl-8-(methylideneamino)-10-phenylphenazin-10-ium-2-yl]prop-2-en-1-imine (CID 130467467) is N-[3,7-dimethyl-8-(methylideneamino)-10-phenylphenazin-10-ium-2-yl]prop-2-en-1-imine.
What is the SMILES notation for N-[3,7-dimethyl-8-(methylideneamino)-10-phenylphenazin-10-ium-2-yl]prop-2-en-1-imine?
The canonical SMILES for N-[3,7-dimethyl-8-(methylideneamino)-10-phenylphenazin-10-ium-2-yl]prop-2-en-1-imine is C=C/C=N/c1cc2c(cc1C)nc1cc(C)c(N=C)cc1[n+]2-c1ccccc1.
What is the InChIKey of N-[3,7-dimethyl-8-(methylideneamino)-10-phenylphenazin-10-ium-2-yl]prop-2-en-1-imine?
The InChIKey is KNJBVMUEHFCZII-UHFFFAOYSA-N. The full InChI is InChI=1S/C24H21N4/c1-5-11-26-20-15-24-22(13-17(20)3)27-21-12-16(2)19(25-4)14-23(21)28(24)18-9-7-6-8-10-18/h5-15H,1,4H2,2-3H3/q+1.
What are the key properties of N-[3,7-dimethyl-8-(methylideneamino)-10-phenylphenazin-10-ium-2-yl]prop-2-en-1-imine?
N-[3,7-dimethyl-8-(methylideneamino)-10-phenylphenazin-10-ium-2-yl]prop-2-en-1-imine has a molecular weight of 365.46 g/mol, XLogP of 5.50, 4 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for N-[3,7-dimethyl-8-(methylideneamino)-10-phenylphenazin-10-ium-2-yl]prop-2-en-1-imine is sourced from PubChem (CID 130467467), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).