C12H13Cl2F3N2O — CID 130467597
N-[3-[(3,5-dichlorophenyl)methylamino]propyl]-2,2,2-trifluoroacetamide (PubChem CID 130467597) has the molecular formula C12H13Cl2F3N2O and a molecular weight of 329.15 g/mol. Its IUPAC name is N-[3-[(3,5-dichlorophenyl)methylamino]propyl]-2,2,2-trifluoroacetamide.
| Compound Name | N-[3-[(3,5-dichlorophenyl)methylamino]propyl]-2,2,2-trifluoroacetamide |
|---|---|
| PubChem CID | 130467597 |
| Molecular Formula | C12H13Cl2F3N2O |
| Molecular Weight | 329.15 g/mol |
| Exact Mass | 328.04 |
| IUPAC Name | N-[3-[(3,5-dichlorophenyl)methylamino]propyl]-2,2,2-trifluoroacetamide |
| SMILES | O=C(NCCCNCc1cc(Cl)cc(Cl)c1)C(F)(F)F |
| InChI | InChI=1S/C12H13Cl2F3N2O/c13-9-4-8(5-10(14)6-9)7-18-2-1-3-19-11(20)12(15,16)17/h4-6,18H,1-3,7H2,(H,19,20) |
| InChIKey | DCWGBJJDLDWCGJ-UHFFFAOYSA-N |
| XLogP | 3.15 |
| TPSA | 41.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 329.15 |
| LogP ≤ 5 | 3.15 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|