C21H28O3 — CID 130467628
(1E,4S,10Z,13S)-13-methyl-4-[(Z)-pent-2-enyl]-5-oxabicyclo[11.3.0]hexadeca-1,10,14-triene-6,16-dione (PubChem CID 130467628) has the molecular formula C21H28O3 and a molecular weight of 328.45 g/mol. Its IUPAC name is (1E,4S,10Z,13S)-13-methyl-4-[(Z)-pent-2-enyl]-5-oxabicyclo[11.3.0]hexadeca-1,10,14-triene-6,16-dione.
| Compound Name | (1E,4S,10Z,13S)-13-methyl-4-[(Z)-pent-2-enyl]-5-oxabicyclo[11.3.0]hexadeca-1,10,14-triene-6,16-dione |
|---|---|
| PubChem CID | 130467628 |
| Molecular Formula | C21H28O3 |
| Molecular Weight | 328.45 g/mol |
| Exact Mass | 328.20 |
| IUPAC Name | (1E,4S,10Z,13S)-13-methyl-4-[(Z)-pent-2-enyl]-5-oxabicyclo[11.3.0]hexadeca-1,10,14-triene-6,16-dione |
| SMILES | CC/C=C\C[C@H]1C/C=C2/C(=O)C=C[C@]2(C)C/C=C\CCCC(=O)O1 |
| InChI | InChI=1S/C21H28O3/c1-3-4-7-10-17-12-13-18-19(22)14-16-21(18,2)15-9-6-5-8-11-20(23)24-17/h4,6-7,9,13-14,16-17H,3,5,8,10-12,15H2,1-2H3/b7-4-,9-6-,18-13-/t17-,21-/m0/s1 |
| InChIKey | VGMRFNBNUYMYIP-BXSZNQGLSA-N |
| XLogP | 4.85 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 328.45 |
| LogP ≤ 5 | 4.85 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|