C22H32O4 — CID 130467638
methyl (Z)-7-[(1R,5E)-5-[(Z,3S)-3-hydroxyoct-5-enylidene]-1-methyl-4-oxocyclopent-2-en-1-yl]hept-5-enoate (PubChem CID 130467638) has the molecular formula C22H32O4 and a molecular weight of 360.49 g/mol. Its IUPAC name is methyl (Z)-7-[(1R,5E)-5-[(Z,3S)-3-hydroxyoct-5-enylidene]-1-methyl-4-oxocyclopent-2-en-1-yl]hept-5-enoate.
| Compound Name | methyl (Z)-7-[(1R,5E)-5-[(Z,3S)-3-hydroxyoct-5-enylidene]-1-methyl-4-oxocyclopent-2-en-1-yl]hept-5-enoate |
|---|---|
| PubChem CID | 130467638 |
| Molecular Formula | C22H32O4 |
| Molecular Weight | 360.49 g/mol |
| Exact Mass | 360.23 |
| IUPAC Name | methyl (Z)-7-[(1R,5E)-5-[(Z,3S)-3-hydroxyoct-5-enylidene]-1-methyl-4-oxocyclopent-2-en-1-yl]hept-5-enoate |
| SMILES | CC/C=C\C[C@H](O)C/C=C1/C(=O)C=C[C@@]1(C)C/C=C\CCCC(=O)OC |
| InChI | InChI=1S/C22H32O4/c1-4-5-8-11-18(23)13-14-19-20(24)15-17-22(19,2)16-10-7-6-9-12-21(25)26-3/h5,7-8,10,14-15,17-18,23H,4,6,9,11-13,16H2,1-3H3/b8-5-,10-7-,19-14-/t18-,22+/m0/s1 |
| InChIKey | IQVMBQSUSIZJBQ-XJTWCDGTSA-N |
| XLogP | 4.45 |
| TPSA | 63.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 360.49 |
| LogP ≤ 5 | 4.45 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|