C20H26O3 — CID 130467644
(1E,4R,10Z,13R)-4-[(Z)-pent-2-enyl]-5-oxabicyclo[11.3.0]hexadeca-1,10,14-triene-6,16-dione (PubChem CID 130467644) has the molecular formula C20H26O3 and a molecular weight of 314.43 g/mol. Its IUPAC name is (1E,4R,10Z,13R)-4-[(Z)-pent-2-enyl]-5-oxabicyclo[11.3.0]hexadeca-1,10,14-triene-6,16-dione.
| Compound Name | (1E,4R,10Z,13R)-4-[(Z)-pent-2-enyl]-5-oxabicyclo[11.3.0]hexadeca-1,10,14-triene-6,16-dione |
|---|---|
| PubChem CID | 130467644 |
| Molecular Formula | C20H26O3 |
| Molecular Weight | 314.43 g/mol |
| Exact Mass | 314.19 |
| IUPAC Name | (1E,4R,10Z,13R)-4-[(Z)-pent-2-enyl]-5-oxabicyclo[11.3.0]hexadeca-1,10,14-triene-6,16-dione |
| SMILES | CC/C=C\C[C@@H]1C/C=C2/C(=O)C=C[C@H]2C/C=C\CCCC(=O)O1 |
| InChI | InChI=1S/C20H26O3/c1-2-3-6-10-17-13-14-18-16(12-15-19(18)21)9-7-4-5-8-11-20(22)23-17/h3-4,6-7,12,14-17H,2,5,8-11,13H2,1H3/b6-3-,7-4-,18-14+/t16-,17-/m1/s1 |
| InChIKey | GHFBWRGTHVTGIQ-AJNOBVHBSA-N |
| XLogP | 4.46 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 314.43 |
| LogP ≤ 5 | 4.46 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|