About [(Z,1E)-1-(2-methyl-5-oxocyclopent-3-en-1-ylidene)oct-5-en-3-yl] (Z)-hept-5-enoate
[(Z,1E)-1-(2-methyl-5-oxocyclopent-3-en-1-ylidene)oct-5-en-3-yl] (Z)-hept-5-enoate (PubChem CID 130467648) has the molecular formula C21H30O3
and a molecular weight of 330.47 g/mol. Its IUPAC name is [(Z,1E)-1-(2-methyl-5-oxocyclopent-3-en-1-ylidene)oct-5-en-3-yl] (Z)-hept-5-enoate.
Molecular Properties
| Compound Name | [(Z,1E)-1-(2-methyl-5-oxocyclopent-3-en-1-ylidene)oct-5-en-3-yl] (Z)-hept-5-enoate |
| PubChem CID | 130467648 |
| Molecular Formula | C21H30O3 |
| Molecular Weight | 330.47 g/mol |
| Exact Mass | 330.22 |
| IUPAC Name | [(Z,1E)-1-(2-methyl-5-oxocyclopent-3-en-1-ylidene)oct-5-en-3-yl] (Z)-hept-5-enoate |
| SMILES | C/C=C\CCCC(=O)OC(C/C=C\CC)C/C=C1/C(=O)C=CC1C |
| InChI | InChI=1S/C21H30O3/c1-4-6-8-10-12-21(23)24-18(11-9-7-5-2)14-15-19-17(3)13-16-20(19)22/h4,6-7,9,13,15-18H,5,8,10-12,14H2,1-3H3/b6-4-,9-7-,19-15+ |
| InChIKey | WXSWNPAZGCINPY-WEYFEMHISA-N |
| XLogP | 5.09 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 330.47 |
| LogP ≤ 5 | 5.09 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|
Analyze [(Z,1E)-1-(2-methyl-5-oxocyclopent-3-en-1-ylidene)oct-5-en-3-yl] (Z)-hept-5-enoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [(Z,1E)-1-(2-methyl-5-oxocyclopent-3-en-1-ylidene)oct-5-en-3-yl] (Z)-hept-5-enoate?
The IUPAC name of [(Z,1E)-1-(2-methyl-5-oxocyclopent-3-en-1-ylidene)oct-5-en-3-yl] (Z)-hept-5-enoate (CID 130467648) is [(Z,1E)-1-(2-methyl-5-oxocyclopent-3-en-1-ylidene)oct-5-en-3-yl] (Z)-hept-5-enoate.
What is the SMILES notation for [(Z,1E)-1-(2-methyl-5-oxocyclopent-3-en-1-ylidene)oct-5-en-3-yl] (Z)-hept-5-enoate?
The canonical SMILES for [(Z,1E)-1-(2-methyl-5-oxocyclopent-3-en-1-ylidene)oct-5-en-3-yl] (Z)-hept-5-enoate is C/C=C\CCCC(=O)OC(C/C=C\CC)C/C=C1/C(=O)C=CC1C.
What is the InChIKey of [(Z,1E)-1-(2-methyl-5-oxocyclopent-3-en-1-ylidene)oct-5-en-3-yl] (Z)-hept-5-enoate?
The InChIKey is WXSWNPAZGCINPY-WEYFEMHISA-N. The full InChI is InChI=1S/C21H30O3/c1-4-6-8-10-12-21(23)24-18(11-9-7-5-2)14-15-19-17(3)13-16-20(19)22/h4,6-7,9,13,15-18H,5,8,10-12,14H2,1-3H3/b6-4-,9-7-,19-15+.
What are the key properties of [(Z,1E)-1-(2-methyl-5-oxocyclopent-3-en-1-ylidene)oct-5-en-3-yl] (Z)-hept-5-enoate?
[(Z,1E)-1-(2-methyl-5-oxocyclopent-3-en-1-ylidene)oct-5-en-3-yl] (Z)-hept-5-enoate has a molecular weight of 330.47 g/mol, XLogP of 5.09, 10 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for [(Z,1E)-1-(2-methyl-5-oxocyclopent-3-en-1-ylidene)oct-5-en-3-yl] (Z)-hept-5-enoate is sourced from PubChem (CID 130467648), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).