C23H31FO5 — CID 130467654
methyl (Z)-7-[(1S,5E)-5-[(Z,3S)-3-acetyloxyoct-5-enylidene]-3-fluoro-4-oxocyclopent-2-en-1-yl]hept-5-enoate (PubChem CID 130467654) has the molecular formula C23H31FO5 and a molecular weight of 406.49 g/mol. Its IUPAC name is methyl (Z)-7-[(1S,5E)-5-[(Z,3S)-3-acetyloxyoct-5-enylidene]-3-fluoro-4-oxocyclopent-2-en-1-yl]hept-5-enoate.
| Compound Name | methyl (Z)-7-[(1S,5E)-5-[(Z,3S)-3-acetyloxyoct-5-enylidene]-3-fluoro-4-oxocyclopent-2-en-1-yl]hept-5-enoate |
|---|---|
| PubChem CID | 130467654 |
| Molecular Formula | C23H31FO5 |
| Molecular Weight | 406.49 g/mol |
| Exact Mass | 406.22 |
| IUPAC Name | methyl (Z)-7-[(1S,5E)-5-[(Z,3S)-3-acetyloxyoct-5-enylidene]-3-fluoro-4-oxocyclopent-2-en-1-yl]hept-5-enoate |
| SMILES | CC/C=C\C[C@@H](C/C=C1/C(=O)C(F)=C[C@@H]1C/C=C\CCCC(=O)OC)OC(C)=O |
| InChI | InChI=1S/C23H31FO5/c1-4-5-8-12-19(29-17(2)25)14-15-20-18(16-21(24)23(20)27)11-9-6-7-10-13-22(26)28-3/h5-6,8-9,15-16,18-19H,4,7,10-14H2,1-3H3/b8-5-,9-6-,20-15+/t18-,19-/m0/s1 |
| InChIKey | AIJZNIADFZZBDT-BZRHDBFHSA-N |
| XLogP | 4.93 |
| TPSA | 69.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 406.49 |
| LogP ≤ 5 | 4.93 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'ene_one_hal(17)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|