C23H32N2O4 — CID 130467665
methyl (Z)-7-[(1S,5E)-5-[(3S)-5-(1,5-dimethylpyrazol-3-yl)-3-hydroxypentylidene]-4-oxocyclopent-2-en-1-yl]hept-5-enoate (PubChem CID 130467665) has the molecular formula C23H32N2O4 and a molecular weight of 400.52 g/mol. Its IUPAC name is methyl (Z)-7-[(1S,5E)-5-[(3S)-5-(1,5-dimethylpyrazol-3-yl)-3-hydroxypentylidene]-4-oxocyclopent-2-en-1-yl]hept-5-enoate.
| Compound Name | methyl (Z)-7-[(1S,5E)-5-[(3S)-5-(1,5-dimethylpyrazol-3-yl)-3-hydroxypentylidene]-4-oxocyclopent-2-en-1-yl]hept-5-enoate |
|---|---|
| PubChem CID | 130467665 |
| Molecular Formula | C23H32N2O4 |
| Molecular Weight | 400.52 g/mol |
| Exact Mass | 400.24 |
| IUPAC Name | methyl (Z)-7-[(1S,5E)-5-[(3S)-5-(1,5-dimethylpyrazol-3-yl)-3-hydroxypentylidene]-4-oxocyclopent-2-en-1-yl]hept-5-enoate |
| SMILES | COC(=O)CCC/C=C\C[C@H]1C=CC(=O)/C1=C/C[C@@H](O)CCc1cc(C)n(C)n1 |
| InChI | InChI=1S/C23H32N2O4/c1-17-16-19(24-25(17)2)11-12-20(26)13-14-21-18(10-15-22(21)27)8-6-4-5-7-9-23(28)29-3/h4,6,10,14-16,18,20,26H,5,7-9,11-13H2,1-3H3/b6-4-,21-14+/t18-,20-/m0/s1 |
| InChIKey | NJMGHZRADIKRHA-NWYSWPDRSA-N |
| XLogP | 3.38 |
| TPSA | 81.42 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 400.52 |
| LogP ≤ 5 | 3.38 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|