C21H29NO2 — CID 130467672
(1E,4S,10Z,13S)-5-methyl-4-[(Z)-pent-2-enyl]-5-azabicyclo[11.3.0]hexadeca-1,10,14-triene-6,16-dione (PubChem CID 130467672) has the molecular formula C21H29NO2 and a molecular weight of 327.47 g/mol. Its IUPAC name is (1E,4S,10Z,13S)-5-methyl-4-[(Z)-pent-2-enyl]-5-azabicyclo[11.3.0]hexadeca-1,10,14-triene-6,16-dione.
| Compound Name | (1E,4S,10Z,13S)-5-methyl-4-[(Z)-pent-2-enyl]-5-azabicyclo[11.3.0]hexadeca-1,10,14-triene-6,16-dione |
|---|---|
| PubChem CID | 130467672 |
| Molecular Formula | C21H29NO2 |
| Molecular Weight | 327.47 g/mol |
| Exact Mass | 327.22 |
| IUPAC Name | (1E,4S,10Z,13S)-5-methyl-4-[(Z)-pent-2-enyl]-5-azabicyclo[11.3.0]hexadeca-1,10,14-triene-6,16-dione |
| SMILES | CC/C=C\C[C@H]1C/C=C2/C(=O)C=C[C@@H]2C/C=C\CCCC(=O)N1C |
| InChI | InChI=1S/C21H29NO2/c1-3-4-7-11-18-14-15-19-17(13-16-20(19)23)10-8-5-6-9-12-21(24)22(18)2/h4-5,7-8,13,15-18H,3,6,9-12,14H2,1-2H3/b7-4-,8-5-,19-15+/t17-,18-/m0/s1 |
| InChIKey | HVEIAZUIFHGPDW-XMGMMNJSSA-N |
| XLogP | 4.37 |
| TPSA | 37.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 327.47 |
| LogP ≤ 5 | 4.37 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|