C23H34O4 — CID 130467735
propan-2-yl (Z)-7-[(1S,5E)-5-[(Z,3S)-3-hydroxyoct-5-enylidene]-4-oxocyclopent-2-en-1-yl]hept-5-enoate (PubChem CID 130467735) has the molecular formula C23H34O4 and a molecular weight of 374.52 g/mol. Its IUPAC name is propan-2-yl (Z)-7-[(1S,5E)-5-[(Z,3S)-3-hydroxyoct-5-enylidene]-4-oxocyclopent-2-en-1-yl]hept-5-enoate.
| Compound Name | propan-2-yl (Z)-7-[(1S,5E)-5-[(Z,3S)-3-hydroxyoct-5-enylidene]-4-oxocyclopent-2-en-1-yl]hept-5-enoate |
|---|---|
| PubChem CID | 130467735 |
| Molecular Formula | C23H34O4 |
| Molecular Weight | 374.52 g/mol |
| Exact Mass | 374.25 |
| IUPAC Name | propan-2-yl (Z)-7-[(1S,5E)-5-[(Z,3S)-3-hydroxyoct-5-enylidene]-4-oxocyclopent-2-en-1-yl]hept-5-enoate |
| SMILES | CC/C=C\C[C@H](O)C/C=C1/C(=O)C=C[C@@H]1C/C=C\CCCC(=O)OC(C)C |
| InChI | InChI=1S/C23H34O4/c1-4-5-8-12-20(24)15-16-21-19(14-17-22(21)25)11-9-6-7-10-13-23(26)27-18(2)3/h5-6,8-9,14,16-20,24H,4,7,10-13,15H2,1-3H3/b8-5-,9-6-,21-16+/t19-,20-/m0/s1 |
| InChIKey | COPXKMZORFWXCC-NGIWCQTKSA-N |
| XLogP | 4.84 |
| TPSA | 63.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 374.52 |
| LogP ≤ 5 | 4.84 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|