C28H23FN4O8 — CID 130468016
(4aS,12aR)-7-fluoro-1,10,11,12a-tetrahydroxy-9-[(2-indazol-1-ylacetyl)amino]-3,12-dioxo-4a,5,5a,6-tetrahydro-4H-tetracene-2-carboxamide (PubChem CID 130468016) has the molecular formula C28H23FN4O8 and a molecular weight of 562.51 g/mol. Its IUPAC name is (4aS,12aR)-7-fluoro-1,10,11,12a-tetrahydroxy-9-[(2-indazol-1-ylacetyl)amino]-3,12-dioxo-4a,5,5a,6-tetrahydro-4H-tetracene-2-carboxamide.
| Compound Name | (4aS,12aR)-7-fluoro-1,10,11,12a-tetrahydroxy-9-[(2-indazol-1-ylacetyl)amino]-3,12-dioxo-4a,5,5a,6-tetrahydro-4H-tetracene-2-carboxamide |
|---|---|
| PubChem CID | 130468016 |
| Molecular Formula | C28H23FN4O8 |
| Molecular Weight | 562.51 g/mol |
| Exact Mass | 562.15 |
| IUPAC Name | (4aS,12aR)-7-fluoro-1,10,11,12a-tetrahydroxy-9-[(2-indazol-1-ylacetyl)amino]-3,12-dioxo-4a,5,5a,6-tetrahydro-4H-tetracene-2-carboxamide |
| SMILES | NC(=O)C1=C(O)[C@@]2(O)C(=O)C3=C(O)c4c(O)c(NC(=O)Cn5ncc6ccccc65)cc(F)c4CC3C[C@H]2CC1=O |
| InChI | InChI=1S/C28H23FN4O8/c29-15-8-16(32-19(35)10-33-17-4-2-1-3-11(17)9-31-33)23(36)21-14(15)6-12-5-13-7-18(34)22(27(30)40)26(39)28(13,41)25(38)20(12)24(21)37/h1-4,8-9,12-13,36-37,39,41H,5-7,10H2,(H2,30,40)(H,32,35)/t12?,13-,28-/m0/s1 |
| InChIKey | DTENSJUQOWHYTK-XOLIKEJLSA-N |
| XLogP | 1.55 |
| TPSA | 205.07 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 562.51 |
| LogP ≤ 5 | 1.55 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'catechol', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_4', 'substructure': 'N/A'} |
|---|