C19H19NO2 — CID 13046809
5-ethoxy-4-methyl-3,5-diphenyl-1H-pyrrol-2-one (PubChem CID 13046809) has the molecular formula C19H19NO2 and a molecular weight of 293.37 g/mol. Its IUPAC name is 5-ethoxy-4-methyl-3,5-diphenyl-1H-pyrrol-2-one.
| Compound Name | 5-ethoxy-4-methyl-3,5-diphenyl-1H-pyrrol-2-one |
|---|---|
| PubChem CID | 13046809 |
| Molecular Formula | C19H19NO2 |
| Molecular Weight | 293.37 g/mol |
| Exact Mass | 293.14 |
| IUPAC Name | 5-ethoxy-4-methyl-3,5-diphenyl-1H-pyrrol-2-one |
| SMILES | CCOC1(c2ccccc2)NC(=O)C(c2ccccc2)=C1C |
| InChI | InChI=1S/C19H19NO2/c1-3-22-19(16-12-8-5-9-13-16)14(2)17(18(21)20-19)15-10-6-4-7-11-15/h4-13H,3H2,1-2H3,(H,20,21) |
| InChIKey | VUJRAVKAAYXHPA-UHFFFAOYSA-N |
| XLogP | 3.48 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 293.37 |
| LogP ≤ 5 | 3.48 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |