About 1-(1-chloroethyl)-3,9-dimethyl-1,2-dihydrobenzo[e]indol-5-ol
1-(1-chloroethyl)-3,9-dimethyl-1,2-dihydrobenzo[e]indol-5-ol (PubChem CID 130468331) has the molecular formula C16H18ClNO
and a molecular weight of 275.78 g/mol. Its IUPAC name is 1-(1-chloroethyl)-3,9-dimethyl-1,2-dihydrobenzo[e]indol-5-ol.
Molecular Properties
| Compound Name | 1-(1-chloroethyl)-3,9-dimethyl-1,2-dihydrobenzo[e]indol-5-ol |
| PubChem CID | 130468331 |
| Molecular Formula | C16H18ClNO |
| Molecular Weight | 275.78 g/mol |
| Exact Mass | 275.11 |
| IUPAC Name | 1-(1-chloroethyl)-3,9-dimethyl-1,2-dihydrobenzo[e]indol-5-ol |
| SMILES | Cc1cccc2c(O)cc3c(c12)C(C(C)Cl)CN3C |
| InChI | InChI=1S/C16H18ClNO/c1-9-5-4-6-11-14(19)7-13-16(15(9)11)12(10(2)17)8-18(13)3/h4-7,10,12,19H,8H2,1-3H3 |
| InChIKey | ZQUYWKLATKLQEZ-UHFFFAOYSA-N |
| XLogP | 4.01 |
| TPSA | 23.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 275.78 |
| LogP ≤ 5 | 4.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|
Analyze 1-(1-chloroethyl)-3,9-dimethyl-1,2-dihydrobenzo[e]indol-5-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-(1-chloroethyl)-3,9-dimethyl-1,2-dihydrobenzo[e]indol-5-ol?
The IUPAC name of 1-(1-chloroethyl)-3,9-dimethyl-1,2-dihydrobenzo[e]indol-5-ol (CID 130468331) is 1-(1-chloroethyl)-3,9-dimethyl-1,2-dihydrobenzo[e]indol-5-ol.
What is the SMILES notation for 1-(1-chloroethyl)-3,9-dimethyl-1,2-dihydrobenzo[e]indol-5-ol?
The canonical SMILES for 1-(1-chloroethyl)-3,9-dimethyl-1,2-dihydrobenzo[e]indol-5-ol is Cc1cccc2c(O)cc3c(c12)C(C(C)Cl)CN3C.
What is the InChIKey of 1-(1-chloroethyl)-3,9-dimethyl-1,2-dihydrobenzo[e]indol-5-ol?
The InChIKey is ZQUYWKLATKLQEZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H18ClNO/c1-9-5-4-6-11-14(19)7-13-16(15(9)11)12(10(2)17)8-18(13)3/h4-7,10,12,19H,8H2,1-3H3.
What are the key properties of 1-(1-chloroethyl)-3,9-dimethyl-1,2-dihydrobenzo[e]indol-5-ol?
1-(1-chloroethyl)-3,9-dimethyl-1,2-dihydrobenzo[e]indol-5-ol has a molecular weight of 275.78 g/mol, XLogP of 4.01, 1 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 1-(1-chloroethyl)-3,9-dimethyl-1,2-dihydrobenzo[e]indol-5-ol is sourced from PubChem (CID 130468331), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).