C26H42N2S — CID 130468485
N-(3-cyclohexa-1,4-dien-1-ylpropyl)-N'-[2,4,6-tri(propan-2-yl)phenyl]sulfanylethane-1,2-diamine (PubChem CID 130468485) has the molecular formula C26H42N2S and a molecular weight of 414.70 g/mol. Its IUPAC name is N-(3-cyclohexa-1,4-dien-1-ylpropyl)-N'-[2,4,6-tri(propan-2-yl)phenyl]sulfanylethane-1,2-diamine.
| Compound Name | N-(3-cyclohexa-1,4-dien-1-ylpropyl)-N'-[2,4,6-tri(propan-2-yl)phenyl]sulfanylethane-1,2-diamine |
|---|---|
| PubChem CID | 130468485 |
| Molecular Formula | C26H42N2S |
| Molecular Weight | 414.70 g/mol |
| Exact Mass | 414.31 |
| IUPAC Name | N-(3-cyclohexa-1,4-dien-1-ylpropyl)-N'-[2,4,6-tri(propan-2-yl)phenyl]sulfanylethane-1,2-diamine |
| SMILES | CC(C)c1cc(C(C)C)c(SNCCNCCCC2=CCC=CC2)c(C(C)C)c1 |
| InChI | InChI=1S/C26H42N2S/c1-19(2)23-17-24(20(3)4)26(25(18-23)21(5)6)29-28-16-15-27-14-10-13-22-11-8-7-9-12-22/h7-8,12,17-21,27-28H,9-11,13-16H2,1-6H3 |
| InChIKey | RKPDSFXYKSATHZ-UHFFFAOYSA-N |
| XLogP | 7.30 |
| TPSA | 24.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 414.70 |
| LogP ≤ 5 | 7.30 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|