C26H40O — CID 130468712
4-tert-butyl-10-[(1E,4E)-2,3,3-trimethyl-4-[(Z)-prop-1-enyl]hepta-1,4-dienyl]-9-oxatricyclo[6.1.1.02,7]dec-3-ene (PubChem CID 130468712) has the molecular formula C26H40O and a molecular weight of 368.61 g/mol. Its IUPAC name is 4-tert-butyl-10-[(1E,4E)-2,3,3-trimethyl-4-[(Z)-prop-1-enyl]hepta-1,4-dienyl]-9-oxatricyclo[6.1.1.02,7]dec-3-ene.
| Compound Name | 4-tert-butyl-10-[(1E,4E)-2,3,3-trimethyl-4-[(Z)-prop-1-enyl]hepta-1,4-dienyl]-9-oxatricyclo[6.1.1.02,7]dec-3-ene |
|---|---|
| PubChem CID | 130468712 |
| Molecular Formula | C26H40O |
| Molecular Weight | 368.61 g/mol |
| Exact Mass | 368.31 |
| IUPAC Name | 4-tert-butyl-10-[(1E,4E)-2,3,3-trimethyl-4-[(Z)-prop-1-enyl]hepta-1,4-dienyl]-9-oxatricyclo[6.1.1.02,7]dec-3-ene |
| SMILES | C/C=C\C(=C/CC)C(C)(C)/C(C)=C/C1C2OC1C1CCC(C(C)(C)C)=CC12 |
| InChI | InChI=1S/C26H40O/c1-9-11-18(12-10-2)26(7,8)17(3)15-22-23-20-14-13-19(25(4,5)6)16-21(20)24(22)27-23/h9,11-12,15-16,20-24H,10,13-14H2,1-8H3/b11-9-,17-15+,18-12+ |
| InChIKey | DLNADMYWFNZPTR-SIBACAMPSA-N |
| XLogP | 7.27 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 368.61 |
| LogP ≤ 5 | 7.27 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|