About phenazin-1-ylmethanediol
phenazin-1-ylmethanediol (PubChem CID 130468741) has the molecular formula C13H10N2O2
and a molecular weight of 226.24 g/mol. Its IUPAC name is phenazin-1-ylmethanediol.
Molecular Properties
| Compound Name | phenazin-1-ylmethanediol |
| PubChem CID | 130468741 |
| Molecular Formula | C13H10N2O2 |
| Molecular Weight | 226.24 g/mol |
| Exact Mass | 226.07 |
| IUPAC Name | phenazin-1-ylmethanediol |
| SMILES | OC(O)c1cccc2nc3ccccc3nc12 |
| InChI | InChI=1S/C13H10N2O2/c16-13(17)8-4-3-7-11-12(8)15-10-6-2-1-5-9(10)14-11/h1-7,13,16-17H |
| InChIKey | KLKWTHDCLSFHCI-UHFFFAOYSA-N |
| XLogP | 1.77 |
| TPSA | 66.24 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 226.24 |
| LogP ≤ 5 | 1.77 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'} |
|---|
Analyze phenazin-1-ylmethanediol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of phenazin-1-ylmethanediol?
The IUPAC name of phenazin-1-ylmethanediol (CID 130468741) is phenazin-1-ylmethanediol.
What is the SMILES notation for phenazin-1-ylmethanediol?
The canonical SMILES for phenazin-1-ylmethanediol is OC(O)c1cccc2nc3ccccc3nc12.
What is the InChIKey of phenazin-1-ylmethanediol?
The InChIKey is KLKWTHDCLSFHCI-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H10N2O2/c16-13(17)8-4-3-7-11-12(8)15-10-6-2-1-5-9(10)14-11/h1-7,13,16-17H.
What are the key properties of phenazin-1-ylmethanediol?
phenazin-1-ylmethanediol has a molecular weight of 226.24 g/mol, XLogP of 1.77, 1 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for phenazin-1-ylmethanediol is sourced from PubChem (CID 130468741), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).