C21H21ClN6O3 — CID 130469759
1-[2-[1-[5-(3-chlorophenyl)-2-pyridinyl]ethylamino]pyrimidin-4-yl]-4,4-dihydroxy-3-methylimidazolidin-2-one (PubChem CID 130469759) has the molecular formula C21H21ClN6O3 and a molecular weight of 440.89 g/mol. Its IUPAC name is 1-[2-[1-[5-(3-chlorophenyl)-2-pyridinyl]ethylamino]pyrimidin-4-yl]-4,4-dihydroxy-3-methylimidazolidin-2-one.
| Compound Name | 1-[2-[1-[5-(3-chlorophenyl)-2-pyridinyl]ethylamino]pyrimidin-4-yl]-4,4-dihydroxy-3-methylimidazolidin-2-one |
|---|---|
| PubChem CID | 130469759 |
| Molecular Formula | C21H21ClN6O3 |
| Molecular Weight | 440.89 g/mol |
| Exact Mass | 440.14 |
| IUPAC Name | 1-[2-[1-[5-(3-chlorophenyl)-2-pyridinyl]ethylamino]pyrimidin-4-yl]-4,4-dihydroxy-3-methylimidazolidin-2-one |
| SMILES | CC(Nc1nccc(N2CC(O)(O)N(C)C2=O)n1)c1ccc(-c2cccc(Cl)c2)cn1 |
| InChI | InChI=1S/C21H21ClN6O3/c1-13(17-7-6-15(11-24-17)14-4-3-5-16(22)10-14)25-19-23-9-8-18(26-19)28-12-21(30,31)27(2)20(28)29/h3-11,13,30-31H,12H2,1-2H3,(H,23,25,26) |
| InChIKey | WUPFCMJGHAVHIK-UHFFFAOYSA-N |
| XLogP | 2.88 |
| TPSA | 114.71 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 440.89 |
| LogP ≤ 5 | 2.88 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|