C25H28N6O4 — CID 130469892
N-[5-amino-4-(2-methoxyethylamino)-2-pyridinyl]-7-formyl-6-(3-methoxyphenyl)-3,4-dihydro-2H-1,8-naphthyridine-1-carboxamide (PubChem CID 130469892) has the molecular formula C25H28N6O4 and a molecular weight of 476.54 g/mol. Its IUPAC name is N-[5-amino-4-(2-methoxyethylamino)-2-pyridinyl]-7-formyl-6-(3-methoxyphenyl)-3,4-dihydro-2H-1,8-naphthyridine-1-carboxamide.
| Compound Name | N-[5-amino-4-(2-methoxyethylamino)-2-pyridinyl]-7-formyl-6-(3-methoxyphenyl)-3,4-dihydro-2H-1,8-naphthyridine-1-carboxamide |
|---|---|
| PubChem CID | 130469892 |
| Molecular Formula | C25H28N6O4 |
| Molecular Weight | 476.54 g/mol |
| Exact Mass | 476.22 |
| IUPAC Name | N-[5-amino-4-(2-methoxyethylamino)-2-pyridinyl]-7-formyl-6-(3-methoxyphenyl)-3,4-dihydro-2H-1,8-naphthyridine-1-carboxamide |
| SMILES | COCCNc1cc(NC(=O)N2CCCc3cc(-c4cccc(OC)c4)c(C=O)nc32)ncc1N |
| InChI | InChI=1S/C25H28N6O4/c1-34-10-8-27-21-13-23(28-14-20(21)26)30-25(33)31-9-4-6-17-12-19(22(15-32)29-24(17)31)16-5-3-7-18(11-16)35-2/h3,5,7,11-15H,4,6,8-10,26H2,1-2H3,(H2,27,28,30,33) |
| InChIKey | OUWQBSRVSFCHSX-UHFFFAOYSA-N |
| XLogP | 3.59 |
| TPSA | 131.70 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 476.54 |
| LogP ≤ 5 | 3.59 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|