C16H29N — CID 130469959
(3R,4R,6Z,8Z)-3-ethyl-N,N,2-trimethyl-5-methylidenedeca-6,8-dien-4-amine (PubChem CID 130469959) has the molecular formula C16H29N and a molecular weight of 235.41 g/mol. Its IUPAC name is (3R,4R,6Z,8Z)-3-ethyl-N,N,2-trimethyl-5-methylidenedeca-6,8-dien-4-amine.
| Compound Name | (3R,4R,6Z,8Z)-3-ethyl-N,N,2-trimethyl-5-methylidenedeca-6,8-dien-4-amine |
|---|---|
| PubChem CID | 130469959 |
| Molecular Formula | C16H29N |
| Molecular Weight | 235.41 g/mol |
| Exact Mass | 235.23 |
| IUPAC Name | (3R,4R,6Z,8Z)-3-ethyl-N,N,2-trimethyl-5-methylidenedeca-6,8-dien-4-amine |
| SMILES | C=C(/C=C\C=C/C)[C@@H]([C@H](CC)C(C)C)N(C)C |
| InChI | InChI=1S/C16H29N/c1-8-10-11-12-14(5)16(17(6)7)15(9-2)13(3)4/h8,10-13,15-16H,5,9H2,1-4,6-7H3/b10-8-,12-11-/t15-,16+/m1/s1 |
| InChIKey | FVEIVMMUUUIWIL-WRPGOPMYSA-N |
| XLogP | 4.29 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 235.41 |
| LogP ≤ 5 | 4.29 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|