C56H41N5 — CID 130469961
4-[3,5-bis(3-pyridin-3-ylphenyl)phenyl]-6-(4-phenylphenyl)-2-[(2E,4E)-5-pyridin-4-ylhepta-2,4,6-trien-2-yl]pyrimidine (PubChem CID 130469961) has the molecular formula C56H41N5 and a molecular weight of 783.98 g/mol. Its IUPAC name is 4-[3,5-bis(3-pyridin-3-ylphenyl)phenyl]-6-(4-phenylphenyl)-2-[(2E,4E)-5-pyridin-4-ylhepta-2,4,6-trien-2-yl]pyrimidine.
| Compound Name | 4-[3,5-bis(3-pyridin-3-ylphenyl)phenyl]-6-(4-phenylphenyl)-2-[(2E,4E)-5-pyridin-4-ylhepta-2,4,6-trien-2-yl]pyrimidine |
|---|---|
| PubChem CID | 130469961 |
| Molecular Formula | C56H41N5 |
| Molecular Weight | 783.98 g/mol |
| Exact Mass | 783.34 |
| IUPAC Name | 4-[3,5-bis(3-pyridin-3-ylphenyl)phenyl]-6-(4-phenylphenyl)-2-[(2E,4E)-5-pyridin-4-ylhepta-2,4,6-trien-2-yl]pyrimidine |
| SMILES | C=C/C(=C\C=C(/C)c1nc(-c2ccc(-c3ccccc3)cc2)cc(-c2cc(-c3cccc(-c4cccnc4)c3)cc(-c3cccc(-c4cccnc4)c3)c2)n1)c1ccncc1 |
| InChI | InChI=1S/C56H41N5/c1-3-40(43-25-29-57-30-26-43)20-19-39(2)56-60-54(44-23-21-42(22-24-44)41-11-5-4-6-12-41)36-55(61-56)53-34-51(47-15-7-13-45(31-47)49-17-9-27-58-37-49)33-52(35-53)48-16-8-14-46(32-48)50-18-10-28-59-38-50/h3-38H,1H2,2H3/b39-19+,40-20+ |
| InChIKey | RBQDRUDKRHNVLJ-DVIGQUAASA-N |
| XLogP | 14.00 |
| TPSA | 64.45 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 61 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 783.98 |
| LogP ≤ 5 | 14.00 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|