About 2-naphthalen-1-ylethanol
2-naphthalen-1-ylethanol (PubChem CID 13047) has the molecular formula C12H12O
and a molecular weight of 172.23 g/mol. Its IUPAC name is 2-naphthalen-1-ylethanol.
Molecular Properties
| Compound Name | 2-naphthalen-1-ylethanol |
| PubChem CID | 13047 |
| Molecular Formula | C12H12O |
| Molecular Weight | 172.23 g/mol |
| Exact Mass | 172.09 |
| IUPAC Name | 2-naphthalen-1-ylethanol |
| SMILES | OCCc1cccc2ccccc12 |
| InChI | InChI=1S/C12H12O/c13-9-8-11-6-3-5-10-4-1-2-7-12(10)11/h1-7,13H,8-9H2 |
| InChIKey | RXWNCMHRJCOWDK-UHFFFAOYSA-N |
| XLogP | 2.37 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 172.23 |
| LogP ≤ 5 | 2.37 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze 2-naphthalen-1-ylethanol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-naphthalen-1-ylethanol?
The IUPAC name of 2-naphthalen-1-ylethanol (CID 13047) is 2-naphthalen-1-ylethanol.
What is the SMILES notation for 2-naphthalen-1-ylethanol?
The canonical SMILES for 2-naphthalen-1-ylethanol is OCCc1cccc2ccccc12.
What is the InChIKey of 2-naphthalen-1-ylethanol?
The InChIKey is RXWNCMHRJCOWDK-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H12O/c13-9-8-11-6-3-5-10-4-1-2-7-12(10)11/h1-7,13H,8-9H2.
What are the key properties of 2-naphthalen-1-ylethanol?
2-naphthalen-1-ylethanol has a molecular weight of 172.23 g/mol, XLogP of 2.37, 2 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 2-naphthalen-1-ylethanol is sourced from PubChem (CID 13047), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).