C18H30O2 — CID 130470454
(2S,3S)-5-methoxy-3-[(3E)-3-methylhexa-3,5-dienyl]-2-[(E)-2-methylpent-1-enyl]oxolane (PubChem CID 130470454) has the molecular formula C18H30O2 and a molecular weight of 278.44 g/mol. Its IUPAC name is (2S,3S)-5-methoxy-3-[(3E)-3-methylhexa-3,5-dienyl]-2-[(E)-2-methylpent-1-enyl]oxolane.
| Compound Name | (2S,3S)-5-methoxy-3-[(3E)-3-methylhexa-3,5-dienyl]-2-[(E)-2-methylpent-1-enyl]oxolane |
|---|---|
| PubChem CID | 130470454 |
| Molecular Formula | C18H30O2 |
| Molecular Weight | 278.44 g/mol |
| Exact Mass | 278.22 |
| IUPAC Name | (2S,3S)-5-methoxy-3-[(3E)-3-methylhexa-3,5-dienyl]-2-[(E)-2-methylpent-1-enyl]oxolane |
| SMILES | C=C/C=C(\C)CC[C@H]1CC(OC)O[C@@H]1/C=C(\C)CCC |
| InChI | InChI=1S/C18H30O2/c1-6-8-14(3)10-11-16-13-18(19-5)20-17(16)12-15(4)9-7-2/h6,8,12,16-18H,1,7,9-11,13H2,2-5H3/b14-8+,15-12+/t16-,17+,18?/m0/s1 |
| InChIKey | ZFUPMPZCEILTNO-QGVAXIBGSA-N |
| XLogP | 5.02 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 20 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 278.44 |
| LogP ≤ 5 | 5.02 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|