C6H4N4 — CID 130470603
1,2,8,9-tetrazabicyclo[5.3.0]deca-2,3,5,7,9-pentaene (PubChem CID 130470603) has the molecular formula C6H4N4 and a molecular weight of 132.13 g/mol. Its IUPAC name is 1,2,8,9-tetrazabicyclo[5.3.0]deca-2,3,5,7,9-pentaene.
| Compound Name | 1,2,8,9-tetrazabicyclo[5.3.0]deca-2,3,5,7,9-pentaene |
|---|---|
| PubChem CID | 130470603 |
| Molecular Formula | C6H4N4 |
| Molecular Weight | 132.13 g/mol |
| Exact Mass | 132.04 |
| IUPAC Name | 1,2,8,9-tetrazabicyclo[5.3.0]deca-2,3,5,7,9-pentaene |
| SMILES | C1=CC=Cc2nncn2N=1 |
| InChI | InChI=1S/C6H4N4/c1-2-4-8-10-5-7-9-6(10)3-1/h1-3,5H |
| InChIKey | XWIDPIMOMDCPFW-UHFFFAOYSA-N |
| XLogP | 0.29 |
| TPSA | 43.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 132.13 |
| LogP ≤ 5 | 0.29 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |