About 1-[2,2-bis[di(propan-2-yloxy)phosphoryl]ethenyl]-3,5-dimethoxybenzene
1-[2,2-bis[di(propan-2-yloxy)phosphoryl]ethenyl]-3,5-dimethoxybenzene (PubChem CID 130470783) has the molecular formula C22H38O8P2
and a molecular weight of 492.49 g/mol. Its IUPAC name is 1-[2,2-bis[di(propan-2-yloxy)phosphoryl]ethenyl]-3,5-dimethoxybenzene.
Molecular Properties
| Compound Name | 1-[2,2-bis[di(propan-2-yloxy)phosphoryl]ethenyl]-3,5-dimethoxybenzene |
| PubChem CID | 130470783 |
| Molecular Formula | C22H38O8P2 |
| Molecular Weight | 492.49 g/mol |
| Exact Mass | 492.20 |
| IUPAC Name | 1-[2,2-bis[di(propan-2-yloxy)phosphoryl]ethenyl]-3,5-dimethoxybenzene |
| SMILES | COc1cc(C=C(P(=O)(OC(C)C)OC(C)C)P(=O)(OC(C)C)OC(C)C)cc(OC)c1 |
| InChI | InChI=1S/C22H38O8P2/c1-15(2)27-31(23,28-16(3)4)22(32(24,29-17(5)6)30-18(7)8)13-19-11-20(25-9)14-21(12-19)26-10/h11-18H,1-10H3 |
| InChIKey | GJDWULMRNXHZDF-UHFFFAOYSA-N |
| XLogP | 7.09 |
| TPSA | 89.52 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 32 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 492.49 |
| LogP ≤ 5 | 7.09 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|
Analyze 1-[2,2-bis[di(propan-2-yloxy)phosphoryl]ethenyl]-3,5-dimethoxybenzene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-[2,2-bis[di(propan-2-yloxy)phosphoryl]ethenyl]-3,5-dimethoxybenzene?
The IUPAC name of 1-[2,2-bis[di(propan-2-yloxy)phosphoryl]ethenyl]-3,5-dimethoxybenzene (CID 130470783) is 1-[2,2-bis[di(propan-2-yloxy)phosphoryl]ethenyl]-3,5-dimethoxybenzene.
What is the SMILES notation for 1-[2,2-bis[di(propan-2-yloxy)phosphoryl]ethenyl]-3,5-dimethoxybenzene?
The canonical SMILES for 1-[2,2-bis[di(propan-2-yloxy)phosphoryl]ethenyl]-3,5-dimethoxybenzene is COc1cc(C=C(P(=O)(OC(C)C)OC(C)C)P(=O)(OC(C)C)OC(C)C)cc(OC)c1.
What is the InChIKey of 1-[2,2-bis[di(propan-2-yloxy)phosphoryl]ethenyl]-3,5-dimethoxybenzene?
The InChIKey is GJDWULMRNXHZDF-UHFFFAOYSA-N. The full InChI is InChI=1S/C22H38O8P2/c1-15(2)27-31(23,28-16(3)4)22(32(24,29-17(5)6)30-18(7)8)13-19-11-20(25-9)14-21(12-19)26-10/h11-18H,1-10H3.
What are the key properties of 1-[2,2-bis[di(propan-2-yloxy)phosphoryl]ethenyl]-3,5-dimethoxybenzene?
1-[2,2-bis[di(propan-2-yloxy)phosphoryl]ethenyl]-3,5-dimethoxybenzene has a molecular weight of 492.49 g/mol, XLogP of 7.09, 13 rotatable bonds, 0 hydrogen bond donors, and 8 hydrogen bond acceptors.
Where does this data come from?
All data for 1-[2,2-bis[di(propan-2-yloxy)phosphoryl]ethenyl]-3,5-dimethoxybenzene is sourced from PubChem (CID 130470783), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).