C8H13NO2 — CID 130470797
(3Z,5E)-8-aminoocta-1,3,5-triene-3,4-diol (PubChem CID 130470797) has the molecular formula C8H13NO2 and a molecular weight of 155.20 g/mol. Its IUPAC name is (3Z,5E)-8-aminoocta-1,3,5-triene-3,4-diol.
| Compound Name | (3Z,5E)-8-aminoocta-1,3,5-triene-3,4-diol |
|---|---|
| PubChem CID | 130470797 |
| Molecular Formula | C8H13NO2 |
| Molecular Weight | 155.20 g/mol |
| Exact Mass | 155.09 |
| IUPAC Name | (3Z,5E)-8-aminoocta-1,3,5-triene-3,4-diol |
| SMILES | C=C/C(O)=C(O)\C=C\CCN |
| InChI | InChI=1S/C8H13NO2/c1-2-7(10)8(11)5-3-4-6-9/h2-3,5,10-11H,1,4,6,9H2/b5-3+,8-7- |
| InChIKey | CCWCBVAMUBNCGT-AXDYLVROSA-N |
| XLogP | 1.40 |
| TPSA | 66.48 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 155.20 |
| LogP ≤ 5 | 1.40 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|