C12H14Br2N2O — CID 13047080
2-[2,6-bis(bromomethyl)-3-pyridinyl]-4,4-dimethyl-5H-1,3-oxazole (PubChem CID 13047080) has the molecular formula C12H14Br2N2O and a molecular weight of 362.07 g/mol. Its IUPAC name is 2-[2,6-bis(bromomethyl)-3-pyridinyl]-4,4-dimethyl-5H-1,3-oxazole.
| Compound Name | 2-[2,6-bis(bromomethyl)-3-pyridinyl]-4,4-dimethyl-5H-1,3-oxazole |
|---|---|
| PubChem CID | 13047080 |
| Molecular Formula | C12H14Br2N2O |
| Molecular Weight | 362.07 g/mol |
| Exact Mass | 359.95 |
| IUPAC Name | 2-[2,6-bis(bromomethyl)-3-pyridinyl]-4,4-dimethyl-5H-1,3-oxazole |
| SMILES | CC1(C)COC(c2ccc(CBr)nc2CBr)=N1 |
| InChI | InChI=1S/C12H14Br2N2O/c1-12(2)7-17-11(16-12)9-4-3-8(5-13)15-10(9)6-14/h3-4H,5-7H2,1-2H3 |
| InChIKey | NEWVFKWRORWZGB-UHFFFAOYSA-N |
| XLogP | 3.43 |
| TPSA | 34.48 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 362.07 |
| LogP ≤ 5 | 3.43 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|