C25H26Cl2N4O3 — CID 130471029
[[6-(2,6-dichloro-3,5-dimethoxyphenyl)-1H-indazol-3-yl]amino]-[4-[(dimethylamino)methyl]phenyl]methanol (PubChem CID 130471029) has the molecular formula C25H26Cl2N4O3 and a molecular weight of 501.41 g/mol. Its IUPAC name is [[6-(2,6-dichloro-3,5-dimethoxyphenyl)-1H-indazol-3-yl]amino]-[4-[(dimethylamino)methyl]phenyl]methanol.
| Compound Name | [[6-(2,6-dichloro-3,5-dimethoxyphenyl)-1H-indazol-3-yl]amino]-[4-[(dimethylamino)methyl]phenyl]methanol |
|---|---|
| PubChem CID | 130471029 |
| Molecular Formula | C25H26Cl2N4O3 |
| Molecular Weight | 501.41 g/mol |
| Exact Mass | 500.14 |
| IUPAC Name | [[6-(2,6-dichloro-3,5-dimethoxyphenyl)-1H-indazol-3-yl]amino]-[4-[(dimethylamino)methyl]phenyl]methanol |
| SMILES | COc1cc(OC)c(Cl)c(-c2ccc3c(NC(O)c4ccc(CN(C)C)cc4)n[nH]c3c2)c1Cl |
| InChI | InChI=1S/C25H26Cl2N4O3/c1-31(2)13-14-5-7-15(8-6-14)25(32)28-24-17-10-9-16(11-18(17)29-30-24)21-22(26)19(33-3)12-20(34-4)23(21)27/h5-12,25,32H,13H2,1-4H3,(H2,28,29,30) |
| InChIKey | DMRSXVMVUBZRHN-UHFFFAOYSA-N |
| XLogP | 5.72 |
| TPSA | 82.64 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 34 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 501.41 |
| LogP ≤ 5 | 5.72 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|