About 1-[4-(5-butyl-1,2-dihydrotriazol-3-yl)phenyl]-3-[2-(trifluoromethyl)phenyl]urea
1-[4-(5-butyl-1,2-dihydrotriazol-3-yl)phenyl]-3-[2-(trifluoromethyl)phenyl]urea (PubChem CID 130471133) has the molecular formula C20H22F3N5O
and a molecular weight of 405.42 g/mol. Its IUPAC name is 1-[4-(5-butyl-1,2-dihydrotriazol-3-yl)phenyl]-3-[2-(trifluoromethyl)phenyl]urea.
Molecular Properties
| Compound Name | 1-[4-(5-butyl-1,2-dihydrotriazol-3-yl)phenyl]-3-[2-(trifluoromethyl)phenyl]urea |
| PubChem CID | 130471133 |
| Molecular Formula | C20H22F3N5O |
| Molecular Weight | 405.42 g/mol |
| Exact Mass | 405.18 |
| IUPAC Name | 1-[4-(5-butyl-1,2-dihydrotriazol-3-yl)phenyl]-3-[2-(trifluoromethyl)phenyl]urea |
| SMILES | CCCCC1=CN(c2ccc(NC(=O)Nc3ccccc3C(F)(F)F)cc2)NN1 |
| InChI | InChI=1S/C20H22F3N5O/c1-2-3-6-15-13-28(27-26-15)16-11-9-14(10-12-16)24-19(29)25-18-8-5-4-7-17(18)20(21,22)23/h4-5,7-13,26-27H,2-3,6H2,1H3,(H2,24,25,29) |
| InChIKey | WQMIPGZTKUSANE-UHFFFAOYSA-N |
| XLogP | 5.21 |
| TPSA | 68.43 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 405.42 |
| LogP ≤ 5 | 5.21 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 1-[4-(5-butyl-1,2-dihydrotriazol-3-yl)phenyl]-3-[2-(trifluoromethyl)phenyl]urea with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-[4-(5-butyl-1,2-dihydrotriazol-3-yl)phenyl]-3-[2-(trifluoromethyl)phenyl]urea?
The IUPAC name of 1-[4-(5-butyl-1,2-dihydrotriazol-3-yl)phenyl]-3-[2-(trifluoromethyl)phenyl]urea (CID 130471133) is 1-[4-(5-butyl-1,2-dihydrotriazol-3-yl)phenyl]-3-[2-(trifluoromethyl)phenyl]urea.
What is the SMILES notation for 1-[4-(5-butyl-1,2-dihydrotriazol-3-yl)phenyl]-3-[2-(trifluoromethyl)phenyl]urea?
The canonical SMILES for 1-[4-(5-butyl-1,2-dihydrotriazol-3-yl)phenyl]-3-[2-(trifluoromethyl)phenyl]urea is CCCCC1=CN(c2ccc(NC(=O)Nc3ccccc3C(F)(F)F)cc2)NN1.
What is the InChIKey of 1-[4-(5-butyl-1,2-dihydrotriazol-3-yl)phenyl]-3-[2-(trifluoromethyl)phenyl]urea?
The InChIKey is WQMIPGZTKUSANE-UHFFFAOYSA-N. The full InChI is InChI=1S/C20H22F3N5O/c1-2-3-6-15-13-28(27-26-15)16-11-9-14(10-12-16)24-19(29)25-18-8-5-4-7-17(18)20(21,22)23/h4-5,7-13,26-27H,2-3,6H2,1H3,(H2,24,25,29).
What are the key properties of 1-[4-(5-butyl-1,2-dihydrotriazol-3-yl)phenyl]-3-[2-(trifluoromethyl)phenyl]urea?
1-[4-(5-butyl-1,2-dihydrotriazol-3-yl)phenyl]-3-[2-(trifluoromethyl)phenyl]urea has a molecular weight of 405.42 g/mol, XLogP of 5.21, 6 rotatable bonds, 4 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 1-[4-(5-butyl-1,2-dihydrotriazol-3-yl)phenyl]-3-[2-(trifluoromethyl)phenyl]urea is sourced from PubChem (CID 130471133), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).