C13H17NO2 — CID 130471182
3-(2-methylpropyl)-1,6,7,8-tetrahydroquinoline-2,5-dione (PubChem CID 130471182) has the molecular formula C13H17NO2 and a molecular weight of 219.28 g/mol. Its IUPAC name is 3-(2-methylpropyl)-1,6,7,8-tetrahydroquinoline-2,5-dione.
| Compound Name | 3-(2-methylpropyl)-1,6,7,8-tetrahydroquinoline-2,5-dione |
|---|---|
| PubChem CID | 130471182 |
| Molecular Formula | C13H17NO2 |
| Molecular Weight | 219.28 g/mol |
| Exact Mass | 219.13 |
| IUPAC Name | 3-(2-methylpropyl)-1,6,7,8-tetrahydroquinoline-2,5-dione |
| SMILES | CC(C)Cc1cc2c([nH]c1=O)CCCC2=O |
| InChI | InChI=1S/C13H17NO2/c1-8(2)6-9-7-10-11(14-13(9)16)4-3-5-12(10)15/h7-8H,3-6H2,1-2H3,(H,14,16) |
| InChIKey | SEJCWCJWAABQOD-UHFFFAOYSA-N |
| XLogP | 2.09 |
| TPSA | 49.93 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 219.28 |
| LogP ≤ 5 | 2.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |