C17H18F3N3O2 — CID 130471261
tert-butyl N-methyl-N-[6-pyridin-3-yl-2-(trifluoromethyl)-3-pyridinyl]carbamate (PubChem CID 130471261) has the molecular formula C17H18F3N3O2 and a molecular weight of 353.34 g/mol. Its IUPAC name is tert-butyl N-methyl-N-[6-pyridin-3-yl-2-(trifluoromethyl)-3-pyridinyl]carbamate.
| Compound Name | tert-butyl N-methyl-N-[6-pyridin-3-yl-2-(trifluoromethyl)-3-pyridinyl]carbamate |
|---|---|
| PubChem CID | 130471261 |
| Molecular Formula | C17H18F3N3O2 |
| Molecular Weight | 353.34 g/mol |
| Exact Mass | 353.14 |
| IUPAC Name | tert-butyl N-methyl-N-[6-pyridin-3-yl-2-(trifluoromethyl)-3-pyridinyl]carbamate |
| SMILES | CN(C(=O)OC(C)(C)C)c1ccc(-c2cccnc2)nc1C(F)(F)F |
| InChI | InChI=1S/C17H18F3N3O2/c1-16(2,3)25-15(24)23(4)13-8-7-12(11-6-5-9-21-10-11)22-14(13)17(18,19)20/h5-10H,1-4H3 |
| InChIKey | LUTYIWLFDSWZOH-UHFFFAOYSA-N |
| XLogP | 4.53 |
| TPSA | 55.32 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 353.34 |
| LogP ≤ 5 | 4.53 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |