C21H24FN3O2 — CID 130471567
[3-(4-fluorophenyl)-4-[(3S)-pyrrolidin-3-yl]oxyphenyl]-piperazin-1-ylmethanone (PubChem CID 130471567) has the molecular formula C21H24FN3O2 and a molecular weight of 369.44 g/mol. Its IUPAC name is [3-(4-fluorophenyl)-4-[(3S)-pyrrolidin-3-yl]oxyphenyl]-piperazin-1-ylmethanone.
| Compound Name | [3-(4-fluorophenyl)-4-[(3S)-pyrrolidin-3-yl]oxyphenyl]-piperazin-1-ylmethanone |
|---|---|
| PubChem CID | 130471567 |
| Molecular Formula | C21H24FN3O2 |
| Molecular Weight | 369.44 g/mol |
| Exact Mass | 369.19 |
| IUPAC Name | [3-(4-fluorophenyl)-4-[(3S)-pyrrolidin-3-yl]oxyphenyl]-piperazin-1-ylmethanone |
| SMILES | O=C(c1ccc(O[C@H]2CCNC2)c(-c2ccc(F)cc2)c1)N1CCNCC1 |
| InChI | InChI=1S/C21H24FN3O2/c22-17-4-1-15(2-5-17)19-13-16(21(26)25-11-9-23-10-12-25)3-6-20(19)27-18-7-8-24-14-18/h1-6,13,18,23-24H,7-12,14H2/t18-/m0/s1 |
| InChIKey | ASIKEABXDBVPDK-SFHVURJKSA-N |
| XLogP | 2.28 |
| TPSA | 53.60 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 369.44 |
| LogP ≤ 5 | 2.28 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |