C40H44N4O4 — CID 130471659
6-(2,4-dihydro-1,3-benzoxazin-3-yl)-3-[[4-[[6-(2,4-dihydro-1,3-benzoxazin-3-yl)-2,4-dihydro-1,3-benzoxazin-3-yl]methyl]cyclohexyl]methyl]-2,4-dihydro-1,3-benzoxazine (PubChem CID 130471659) has the molecular formula C40H44N4O4 and a molecular weight of 644.82 g/mol. Its IUPAC name is 6-(2,4-dihydro-1,3-benzoxazin-3-yl)-3-[[4-[[6-(2,4-dihydro-1,3-benzoxazin-3-yl)-2,4-dihydro-1,3-benzoxazin-3-yl]methyl]cyclohexyl]methyl]-2,4-dihydro-1,3-benzoxazine.
| Compound Name | 6-(2,4-dihydro-1,3-benzoxazin-3-yl)-3-[[4-[[6-(2,4-dihydro-1,3-benzoxazin-3-yl)-2,4-dihydro-1,3-benzoxazin-3-yl]methyl]cyclohexyl]methyl]-2,4-dihydro-1,3-benzoxazine |
|---|---|
| PubChem CID | 130471659 |
| Molecular Formula | C40H44N4O4 |
| Molecular Weight | 644.82 g/mol |
| Exact Mass | 644.34 |
| IUPAC Name | 6-(2,4-dihydro-1,3-benzoxazin-3-yl)-3-[[4-[[6-(2,4-dihydro-1,3-benzoxazin-3-yl)-2,4-dihydro-1,3-benzoxazin-3-yl]methyl]cyclohexyl]methyl]-2,4-dihydro-1,3-benzoxazine |
| SMILES | c1ccc2c(c1)CN(c1ccc3c(c1)CN(CC1CCC(CN4COc5ccc(N6COc7ccccc7C6)cc5C4)CC1)CO3)CO2 |
| InChI | InChI=1S/C40H44N4O4/c1-3-7-37-31(5-1)23-43(27-47-37)35-13-15-39-33(17-35)21-41(25-45-39)19-29-9-11-30(12-10-29)20-42-22-34-18-36(14-16-40(34)46-26-42)44-24-32-6-2-4-8-38(32)48-28-44/h1-8,13-18,29-30H,9-12,19-28H2 |
| InChIKey | CQRKHLZMPPIWMC-UHFFFAOYSA-N |
| XLogP | 7.21 |
| TPSA | 49.88 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 48 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 644.82 |
| LogP ≤ 5 | 7.21 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'} |
|---|