C38H40N4O4 — CID 130471664
6-(2,4-dihydro-1,3-benzoxazin-3-yl)-3-[4-[6-(2,4-dihydro-1,3-benzoxazin-3-yl)-2,4-dihydro-1,3-benzoxazin-3-yl]cyclohexyl]-2,4-dihydro-1,3-benzoxazine (PubChem CID 130471664) has the molecular formula C38H40N4O4 and a molecular weight of 616.76 g/mol. Its IUPAC name is 6-(2,4-dihydro-1,3-benzoxazin-3-yl)-3-[4-[6-(2,4-dihydro-1,3-benzoxazin-3-yl)-2,4-dihydro-1,3-benzoxazin-3-yl]cyclohexyl]-2,4-dihydro-1,3-benzoxazine.
| Compound Name | 6-(2,4-dihydro-1,3-benzoxazin-3-yl)-3-[4-[6-(2,4-dihydro-1,3-benzoxazin-3-yl)-2,4-dihydro-1,3-benzoxazin-3-yl]cyclohexyl]-2,4-dihydro-1,3-benzoxazine |
|---|---|
| PubChem CID | 130471664 |
| Molecular Formula | C38H40N4O4 |
| Molecular Weight | 616.76 g/mol |
| Exact Mass | 616.30 |
| IUPAC Name | 6-(2,4-dihydro-1,3-benzoxazin-3-yl)-3-[4-[6-(2,4-dihydro-1,3-benzoxazin-3-yl)-2,4-dihydro-1,3-benzoxazin-3-yl]cyclohexyl]-2,4-dihydro-1,3-benzoxazine |
| SMILES | c1ccc2c(c1)CN(c1ccc3c(c1)CN(C1CCC(N4COc5ccc(N6COc7ccccc7C6)cc5C4)CC1)CO3)CO2 |
| InChI | InChI=1S/C38H40N4O4/c1-3-7-35-27(5-1)19-41(25-43-35)33-13-15-37-29(17-33)21-39(23-45-37)31-9-11-32(12-10-31)40-22-30-18-34(14-16-38(30)46-24-40)42-20-28-6-2-4-8-36(28)44-26-42/h1-8,13-18,31-32H,9-12,19-26H2 |
| InChIKey | NHWQBKWCEQUHRP-UHFFFAOYSA-N |
| XLogP | 6.71 |
| TPSA | 49.88 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 616.76 |
| LogP ≤ 5 | 6.71 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'} |
|---|