C24H20N4O5S — CID 130471716
2-(3-methyl-2-oxo-1H-benzimidazol-5-yl)-6-[(4-oxo-1,4-oxathian-4-ylidene)amino]benzo[de]isoquinoline-1,3-dione (PubChem CID 130471716) has the molecular formula C24H20N4O5S and a molecular weight of 476.51 g/mol. Its IUPAC name is 2-(3-methyl-2-oxo-1H-benzimidazol-5-yl)-6-[(4-oxo-1,4-oxathian-4-ylidene)amino]benzo[de]isoquinoline-1,3-dione.
| Compound Name | 2-(3-methyl-2-oxo-1H-benzimidazol-5-yl)-6-[(4-oxo-1,4-oxathian-4-ylidene)amino]benzo[de]isoquinoline-1,3-dione |
|---|---|
| PubChem CID | 130471716 |
| Molecular Formula | C24H20N4O5S |
| Molecular Weight | 476.51 g/mol |
| Exact Mass | 476.12 |
| IUPAC Name | 2-(3-methyl-2-oxo-1H-benzimidazol-5-yl)-6-[(4-oxo-1,4-oxathian-4-ylidene)amino]benzo[de]isoquinoline-1,3-dione |
| SMILES | Cn1c(=O)[nH]c2ccc(N3C(=O)c4cccc5c(N=S6(=O)CCOCC6)ccc(c45)C3=O)cc21 |
| InChI | InChI=1S/C24H20N4O5S/c1-27-20-13-14(5-7-19(20)25-24(27)31)28-22(29)16-4-2-3-15-18(8-6-17(21(15)16)23(28)30)26-34(32)11-9-33-10-12-34/h2-8,13H,9-12H2,1H3,(H,25,31) |
| InChIKey | GAWNNNOAVNEBBX-UHFFFAOYSA-N |
| XLogP | 2.95 |
| TPSA | 113.83 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 476.51 |
| LogP ≤ 5 | 2.95 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|