C42H79NO — CID 130471894
(6Z,9Z,28Z,31Z)-19-[4-(methylamino)butyl]heptatriaconta-6,9,28,31-tetraen-19-ol (PubChem CID 130471894) has the molecular formula C42H79NO and a molecular weight of 614.10 g/mol. Its IUPAC name is (6Z,9Z,28Z,31Z)-19-[4-(methylamino)butyl]heptatriaconta-6,9,28,31-tetraen-19-ol.
| Compound Name | (6Z,9Z,28Z,31Z)-19-[4-(methylamino)butyl]heptatriaconta-6,9,28,31-tetraen-19-ol |
|---|---|
| PubChem CID | 130471894 |
| Molecular Formula | C42H79NO |
| Molecular Weight | 614.10 g/mol |
| Exact Mass | 613.62 |
| IUPAC Name | (6Z,9Z,28Z,31Z)-19-[4-(methylamino)butyl]heptatriaconta-6,9,28,31-tetraen-19-ol |
| SMILES | CCCCC/C=C\C/C=C\CCCCCCCCC(O)(CCCCCCCC/C=C\C/C=C\CCCCC)CCCCNC |
| InChI | InChI=1S/C42H79NO/c1-4-6-8-10-12-14-16-18-20-22-24-26-28-30-32-34-38-42(44,40-36-37-41-43-3)39-35-33-31-29-27-25-23-21-19-17-15-13-11-9-7-5-2/h12-15,18-21,43-44H,4-11,16-17,22-41H2,1-3H3/b14-12-,15-13-,20-18-,21-19- |
| InChIKey | JVKQCUAJIBBLLJ-QYCRHRGJSA-N |
| XLogP | 13.51 |
| TPSA | 32.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 35 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 614.10 |
| LogP ≤ 5 | 13.51 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|