C14H18N2 — CID 130472311
N'-[(3Z,5E,6Z)-5-prop-2-enylidenenona-1,3,6,8-tetraen-4-yl]ethanimidamide (PubChem CID 130472311) has the molecular formula C14H18N2 and a molecular weight of 214.31 g/mol. Its IUPAC name is N'-[(3Z,5E,6Z)-5-prop-2-enylidenenona-1,3,6,8-tetraen-4-yl]ethanimidamide.
| Compound Name | N'-[(3Z,5E,6Z)-5-prop-2-enylidenenona-1,3,6,8-tetraen-4-yl]ethanimidamide |
|---|---|
| PubChem CID | 130472311 |
| Molecular Formula | C14H18N2 |
| Molecular Weight | 214.31 g/mol |
| Exact Mass | 214.15 |
| IUPAC Name | N'-[(3Z,5E,6Z)-5-prop-2-enylidenenona-1,3,6,8-tetraen-4-yl]ethanimidamide |
| SMILES | C=C/C=C\C(=C/C=C)C(=C\C=C)\N=C(/C)N |
| InChI | InChI=1S/C14H18N2/c1-5-8-11-13(9-6-2)14(10-7-3)16-12(4)15/h5-11H,1-3H2,4H3,(H2,15,16)/b11-8-,13-9+,14-10- |
| InChIKey | DOKQJYNAJZXYEU-BQUWCNJYSA-N |
| XLogP | 3.29 |
| TPSA | 38.38 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 214.31 |
| LogP ≤ 5 | 3.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|