C8H9F9 — CID 13047336
2-(difluoromethyl)-1,1,1,2,6,6,6-heptafluoro-5-methylhexane (PubChem CID 13047336) has the molecular formula C8H9F9 and a molecular weight of 276.14 g/mol. Its IUPAC name is 2-(difluoromethyl)-1,1,1,2,6,6,6-heptafluoro-5-methylhexane.
| Compound Name | 2-(difluoromethyl)-1,1,1,2,6,6,6-heptafluoro-5-methylhexane |
|---|---|
| PubChem CID | 13047336 |
| Molecular Formula | C8H9F9 |
| Molecular Weight | 276.14 g/mol |
| Exact Mass | 276.06 |
| IUPAC Name | 2-(difluoromethyl)-1,1,1,2,6,6,6-heptafluoro-5-methylhexane |
| SMILES | CC(CCC(F)(C(F)F)C(F)(F)F)C(F)(F)F |
| InChI | InChI=1S/C8H9F9/c1-4(7(12,13)14)2-3-6(11,5(9)10)8(15,16)17/h4-5H,2-3H2,1H3 |
| InChIKey | KKOWXABILQYWTG-UHFFFAOYSA-N |
| XLogP | 4.50 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 276.14 |
| LogP ≤ 5 | 4.50 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |