C11H19N — CID 130473778
N-[(3Z,5E)-6,7-dimethylocta-3,5-dien-3-yl]methanimine (PubChem CID 130473778) has the molecular formula C11H19N and a molecular weight of 165.28 g/mol. Its IUPAC name is N-[(3Z,5E)-6,7-dimethylocta-3,5-dien-3-yl]methanimine.
| Compound Name | N-[(3Z,5E)-6,7-dimethylocta-3,5-dien-3-yl]methanimine |
|---|---|
| PubChem CID | 130473778 |
| Molecular Formula | C11H19N |
| Molecular Weight | 165.28 g/mol |
| Exact Mass | 165.15 |
| IUPAC Name | N-[(3Z,5E)-6,7-dimethylocta-3,5-dien-3-yl]methanimine |
| SMILES | C=N/C(=C\C=C(/C)C(C)C)CC |
| InChI | InChI=1S/C11H19N/c1-6-11(12-5)8-7-10(4)9(2)3/h7-9H,5-6H2,1-4H3/b10-7+,11-8- |
| InChIKey | PFWQIMNAAMYFTM-WAKDDQPJSA-N |
| XLogP | 3.58 |
| TPSA | 12.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 165.28 |
| LogP ≤ 5 | 3.58 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|