C38H44N2O7S — CID 130473791
2-[[4-[3-amino-2-[4-(2,2-dimethylpropoxy)phenyl]-3-oxopropyl]-2-[(2E,4E)-5-(1-benzofuran-2-yl)hepta-2,4-dien-3-yl]benzoyl]amino]ethanesulfonic acid (PubChem CID 130473791) has the molecular formula C38H44N2O7S and a molecular weight of 672.84 g/mol. Its IUPAC name is 2-[[4-[3-amino-2-[4-(2,2-dimethylpropoxy)phenyl]-3-oxopropyl]-2-[(2E,4E)-5-(1-benzofuran-2-yl)hepta-2,4-dien-3-yl]benzoyl]amino]ethanesulfonic acid.
| Compound Name | 2-[[4-[3-amino-2-[4-(2,2-dimethylpropoxy)phenyl]-3-oxopropyl]-2-[(2E,4E)-5-(1-benzofuran-2-yl)hepta-2,4-dien-3-yl]benzoyl]amino]ethanesulfonic acid |
|---|---|
| PubChem CID | 130473791 |
| Molecular Formula | C38H44N2O7S |
| Molecular Weight | 672.84 g/mol |
| Exact Mass | 672.29 |
| IUPAC Name | 2-[[4-[3-amino-2-[4-(2,2-dimethylpropoxy)phenyl]-3-oxopropyl]-2-[(2E,4E)-5-(1-benzofuran-2-yl)hepta-2,4-dien-3-yl]benzoyl]amino]ethanesulfonic acid |
| SMILES | C/C=C(\C=C(/CC)c1cc2ccccc2o1)c1cc(CC(C(N)=O)c2ccc(OCC(C)(C)C)cc2)ccc1C(=O)NCCS(=O)(=O)O |
| InChI | InChI=1S/C38H44N2O7S/c1-6-26(22-27(7-2)35-23-29-10-8-9-11-34(29)47-35)32-20-25(12-17-31(32)37(42)40-18-19-48(43,44)45)21-33(36(39)41)28-13-15-30(16-14-28)46-24-38(3,4)5/h6,8-17,20,22-23,33H,7,18-19,21,24H2,1-5H3,(H2,39,41)(H,40,42)(H,43,44,45)/b26-6+,27-22+ |
| InChIKey | UTKXOFRSKHCXFV-CMEIWBMPSA-N |
| XLogP | 7.18 |
| TPSA | 148.93 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 48 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 672.84 |
| LogP ≤ 5 | 7.18 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|