C20H25N7O3 — CID 130473846
7,8-dihydroxy-16-methyl-4,5,12,15,16,19,25-heptazatetracyclo[19.3.1.12,5.014,18]hexacosa-1(24),2(26),3,14,17,21(25),22-heptaen-13-one (PubChem CID 130473846) has the molecular formula C20H25N7O3 and a molecular weight of 411.47 g/mol. Its IUPAC name is 7,8-dihydroxy-16-methyl-4,5,12,15,16,19,25-heptazatetracyclo[19.3.1.12,5.014,18]hexacosa-1(24),2(26),3,14,17,21(25),22-heptaen-13-one.
| Compound Name | 7,8-dihydroxy-16-methyl-4,5,12,15,16,19,25-heptazatetracyclo[19.3.1.12,5.014,18]hexacosa-1(24),2(26),3,14,17,21(25),22-heptaen-13-one |
|---|---|
| PubChem CID | 130473846 |
| Molecular Formula | C20H25N7O3 |
| Molecular Weight | 411.47 g/mol |
| Exact Mass | 411.20 |
| IUPAC Name | 7,8-dihydroxy-16-methyl-4,5,12,15,16,19,25-heptazatetracyclo[19.3.1.12,5.014,18]hexacosa-1(24),2(26),3,14,17,21(25),22-heptaen-13-one |
| SMILES | Cn1cc2c(n1)C(=O)NCCCC(O)C(O)Cn1cc(cn1)-c1cccc(n1)CN2 |
| InChI | InChI=1S/C20H25N7O3/c1-26-11-16-19(25-26)20(30)21-7-3-6-17(28)18(29)12-27-10-13(8-23-27)15-5-2-4-14(24-15)9-22-16/h2,4-5,8,10-11,17-18,22,28-29H,3,6-7,9,12H2,1H3,(H,21,30) |
| InChIKey | YKWYWJGOKYODQQ-UHFFFAOYSA-N |
| XLogP | 0.54 |
| TPSA | 130.12 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 411.47 |
| LogP ≤ 5 | 0.54 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 9 |