About 5-[[6-methoxy-2-propan-2-yl-5-(trifluoromethyl)-3-pyridinyl]sulfanyl]pyrimidine-2,4-diamine
5-[[6-methoxy-2-propan-2-yl-5-(trifluoromethyl)-3-pyridinyl]sulfanyl]pyrimidine-2,4-diamine (PubChem CID 130474299) has the molecular formula C14H16F3N5OS
and a molecular weight of 359.38 g/mol. Its IUPAC name is 5-[[6-methoxy-2-propan-2-yl-5-(trifluoromethyl)-3-pyridinyl]sulfanyl]pyrimidine-2,4-diamine.
Molecular Properties
| Compound Name | 5-[[6-methoxy-2-propan-2-yl-5-(trifluoromethyl)-3-pyridinyl]sulfanyl]pyrimidine-2,4-diamine |
| PubChem CID | 130474299 |
| Molecular Formula | C14H16F3N5OS |
| Molecular Weight | 359.38 g/mol |
| Exact Mass | 359.10 |
| IUPAC Name | 5-[[6-methoxy-2-propan-2-yl-5-(trifluoromethyl)-3-pyridinyl]sulfanyl]pyrimidine-2,4-diamine |
| SMILES | COc1nc(C(C)C)c(Sc2cnc(N)nc2N)cc1C(F)(F)F |
| InChI | InChI=1S/C14H16F3N5OS/c1-6(2)10-8(24-9-5-20-13(19)22-11(9)18)4-7(14(15,16)17)12(21-10)23-3/h4-6H,1-3H3,(H4,18,19,20,22) |
| InChIKey | JWAMYJNSSIJUKT-UHFFFAOYSA-N |
| XLogP | 3.34 |
| TPSA | 99.94 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 359.38 |
| LogP ≤ 5 | 3.34 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
Analyze 5-[[6-methoxy-2-propan-2-yl-5-(trifluoromethyl)-3-pyridinyl]sulfanyl]pyrimidine-2,4-diamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-[[6-methoxy-2-propan-2-yl-5-(trifluoromethyl)-3-pyridinyl]sulfanyl]pyrimidine-2,4-diamine?
The IUPAC name of 5-[[6-methoxy-2-propan-2-yl-5-(trifluoromethyl)-3-pyridinyl]sulfanyl]pyrimidine-2,4-diamine (CID 130474299) is 5-[[6-methoxy-2-propan-2-yl-5-(trifluoromethyl)-3-pyridinyl]sulfanyl]pyrimidine-2,4-diamine.
What is the SMILES notation for 5-[[6-methoxy-2-propan-2-yl-5-(trifluoromethyl)-3-pyridinyl]sulfanyl]pyrimidine-2,4-diamine?
The canonical SMILES for 5-[[6-methoxy-2-propan-2-yl-5-(trifluoromethyl)-3-pyridinyl]sulfanyl]pyrimidine-2,4-diamine is COc1nc(C(C)C)c(Sc2cnc(N)nc2N)cc1C(F)(F)F.
What is the InChIKey of 5-[[6-methoxy-2-propan-2-yl-5-(trifluoromethyl)-3-pyridinyl]sulfanyl]pyrimidine-2,4-diamine?
The InChIKey is JWAMYJNSSIJUKT-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H16F3N5OS/c1-6(2)10-8(24-9-5-20-13(19)22-11(9)18)4-7(14(15,16)17)12(21-10)23-3/h4-6H,1-3H3,(H4,18,19,20,22).
What are the key properties of 5-[[6-methoxy-2-propan-2-yl-5-(trifluoromethyl)-3-pyridinyl]sulfanyl]pyrimidine-2,4-diamine?
5-[[6-methoxy-2-propan-2-yl-5-(trifluoromethyl)-3-pyridinyl]sulfanyl]pyrimidine-2,4-diamine has a molecular weight of 359.38 g/mol, XLogP of 3.34, 4 rotatable bonds, 2 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for 5-[[6-methoxy-2-propan-2-yl-5-(trifluoromethyl)-3-pyridinyl]sulfanyl]pyrimidine-2,4-diamine is sourced from PubChem (CID 130474299), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).