About 5-[(2,4-diaminopyrimidin-5-yl)amino]-2-methoxy-4-propan-2-ylbenzenesulfinate
5-[(2,4-diaminopyrimidin-5-yl)amino]-2-methoxy-4-propan-2-ylbenzenesulfinate (PubChem CID 130474359) has the molecular formula C14H18N5O3S-
and a molecular weight of 336.40 g/mol. Its IUPAC name is 5-[(2,4-diaminopyrimidin-5-yl)amino]-2-methoxy-4-propan-2-ylbenzenesulfinate.
Molecular Properties
| Compound Name | 5-[(2,4-diaminopyrimidin-5-yl)amino]-2-methoxy-4-propan-2-ylbenzenesulfinate |
| PubChem CID | 130474359 |
| Molecular Formula | C14H18N5O3S- |
| Molecular Weight | 336.40 g/mol |
| Exact Mass | 336.11 |
| IUPAC Name | 5-[(2,4-diaminopyrimidin-5-yl)amino]-2-methoxy-4-propan-2-ylbenzenesulfinate |
| SMILES | COc1cc(C(C)C)c(Nc2cnc(N)nc2N)cc1S(=O)[O-] |
| InChI | InChI=1S/C14H19N5O3S/c1-7(2)8-4-11(22-3)12(23(20)21)5-9(8)18-10-6-17-14(16)19-13(10)15/h4-7,18H,1-3H3,(H,20,21)(H4,15,16,17,19)/p-1 |
| InChIKey | GKIIVOQSNFIYTP-UHFFFAOYSA-M |
| XLogP | 1.75 |
| TPSA | 139.21 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 336.40 |
| LogP ≤ 5 | 1.75 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'sulfinic_acid', 'substructure': 'N/A'} |
|---|
Analyze 5-[(2,4-diaminopyrimidin-5-yl)amino]-2-methoxy-4-propan-2-ylbenzenesulfinate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-[(2,4-diaminopyrimidin-5-yl)amino]-2-methoxy-4-propan-2-ylbenzenesulfinate?
The IUPAC name of 5-[(2,4-diaminopyrimidin-5-yl)amino]-2-methoxy-4-propan-2-ylbenzenesulfinate (CID 130474359) is 5-[(2,4-diaminopyrimidin-5-yl)amino]-2-methoxy-4-propan-2-ylbenzenesulfinate.
What is the SMILES notation for 5-[(2,4-diaminopyrimidin-5-yl)amino]-2-methoxy-4-propan-2-ylbenzenesulfinate?
The canonical SMILES for 5-[(2,4-diaminopyrimidin-5-yl)amino]-2-methoxy-4-propan-2-ylbenzenesulfinate is COc1cc(C(C)C)c(Nc2cnc(N)nc2N)cc1S(=O)[O-].
What is the InChIKey of 5-[(2,4-diaminopyrimidin-5-yl)amino]-2-methoxy-4-propan-2-ylbenzenesulfinate?
The InChIKey is GKIIVOQSNFIYTP-UHFFFAOYSA-M. The full InChI is InChI=1S/C14H19N5O3S/c1-7(2)8-4-11(22-3)12(23(20)21)5-9(8)18-10-6-17-14(16)19-13(10)15/h4-7,18H,1-3H3,(H,20,21)(H4,15,16,17,19)/p-1.
What are the key properties of 5-[(2,4-diaminopyrimidin-5-yl)amino]-2-methoxy-4-propan-2-ylbenzenesulfinate?
5-[(2,4-diaminopyrimidin-5-yl)amino]-2-methoxy-4-propan-2-ylbenzenesulfinate has a molecular weight of 336.40 g/mol, XLogP of 1.75, 5 rotatable bonds, 3 hydrogen bond donors, and 8 hydrogen bond acceptors.
Where does this data come from?
All data for 5-[(2,4-diaminopyrimidin-5-yl)amino]-2-methoxy-4-propan-2-ylbenzenesulfinate is sourced from PubChem (CID 130474359), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).