C9H12ClN5 — CID 130474599
1-(5-chloro-2,3-dihydro-1H-imidazo[4,5-b]pyridin-2-yl)azetidin-3-amine (PubChem CID 130474599) has the molecular formula C9H12ClN5 and a molecular weight of 225.68 g/mol. Its IUPAC name is 1-(5-chloro-2,3-dihydro-1H-imidazo[4,5-b]pyridin-2-yl)azetidin-3-amine.
| Compound Name | 1-(5-chloro-2,3-dihydro-1H-imidazo[4,5-b]pyridin-2-yl)azetidin-3-amine |
|---|---|
| PubChem CID | 130474599 |
| Molecular Formula | C9H12ClN5 |
| Molecular Weight | 225.68 g/mol |
| Exact Mass | 225.08 |
| IUPAC Name | 1-(5-chloro-2,3-dihydro-1H-imidazo[4,5-b]pyridin-2-yl)azetidin-3-amine |
| SMILES | NC1CN(C2Nc3ccc(Cl)nc3N2)C1 |
| InChI | InChI=1S/C9H12ClN5/c10-7-2-1-6-8(13-7)14-9(12-6)15-3-5(11)4-15/h1-2,5,9,12H,3-4,11H2,(H,13,14) |
| InChIKey | FNCYMYOGUJEHAJ-UHFFFAOYSA-N |
| XLogP | 0.50 |
| TPSA | 66.21 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 225.68 |
| LogP ≤ 5 | 0.50 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|