About 5,7-dichloro-4,6-dimethoxy-1,2-benzoxazole
5,7-dichloro-4,6-dimethoxy-1,2-benzoxazole (PubChem CID 13047562) has the molecular formula C9H7Cl2NO3
and a molecular weight of 248.06 g/mol. Its IUPAC name is 5,7-dichloro-4,6-dimethoxy-1,2-benzoxazole.
Molecular Properties
| Compound Name | 5,7-dichloro-4,6-dimethoxy-1,2-benzoxazole |
| PubChem CID | 13047562 |
| Molecular Formula | C9H7Cl2NO3 |
| Molecular Weight | 248.06 g/mol |
| Exact Mass | 246.98 |
| IUPAC Name | 5,7-dichloro-4,6-dimethoxy-1,2-benzoxazole |
| SMILES | COc1c(Cl)c(OC)c2cnoc2c1Cl |
| InChI | InChI=1S/C9H7Cl2NO3/c1-13-7-4-3-12-15-8(4)6(11)9(14-2)5(7)10/h3H,1-2H3 |
| InChIKey | PSEBPMBJKJAVSY-UHFFFAOYSA-N |
| XLogP | 3.15 |
| TPSA | 44.49 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 248.06 |
| LogP ≤ 5 | 3.15 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 5,7-dichloro-4,6-dimethoxy-1,2-benzoxazole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5,7-dichloro-4,6-dimethoxy-1,2-benzoxazole?
The IUPAC name of 5,7-dichloro-4,6-dimethoxy-1,2-benzoxazole (CID 13047562) is 5,7-dichloro-4,6-dimethoxy-1,2-benzoxazole.
What is the SMILES notation for 5,7-dichloro-4,6-dimethoxy-1,2-benzoxazole?
The canonical SMILES for 5,7-dichloro-4,6-dimethoxy-1,2-benzoxazole is COc1c(Cl)c(OC)c2cnoc2c1Cl.
What is the InChIKey of 5,7-dichloro-4,6-dimethoxy-1,2-benzoxazole?
The InChIKey is PSEBPMBJKJAVSY-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H7Cl2NO3/c1-13-7-4-3-12-15-8(4)6(11)9(14-2)5(7)10/h3H,1-2H3.
What are the key properties of 5,7-dichloro-4,6-dimethoxy-1,2-benzoxazole?
5,7-dichloro-4,6-dimethoxy-1,2-benzoxazole has a molecular weight of 248.06 g/mol, XLogP of 3.15, 2 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 5,7-dichloro-4,6-dimethoxy-1,2-benzoxazole is sourced from PubChem (CID 13047562), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).