C9H10N4OS — CID 130475797
1-[(1Z,3E)-hexa-1,3,5-trienyl]-3-(thiadiazol-5-yl)urea (PubChem CID 130475797) has the molecular formula C9H10N4OS and a molecular weight of 222.27 g/mol. Its IUPAC name is 1-[(1Z,3E)-hexa-1,3,5-trienyl]-3-(thiadiazol-5-yl)urea.
| Compound Name | 1-[(1Z,3E)-hexa-1,3,5-trienyl]-3-(thiadiazol-5-yl)urea |
|---|---|
| PubChem CID | 130475797 |
| Molecular Formula | C9H10N4OS |
| Molecular Weight | 222.27 g/mol |
| Exact Mass | 222.06 |
| IUPAC Name | 1-[(1Z,3E)-hexa-1,3,5-trienyl]-3-(thiadiazol-5-yl)urea |
| SMILES | C=C/C=C/C=C\NC(=O)Nc1cnns1 |
| InChI | InChI=1S/C9H10N4OS/c1-2-3-4-5-6-10-9(14)12-8-7-11-13-15-8/h2-7H,1H2,(H2,10,12,14)/b4-3+,6-5- |
| InChIKey | BFEIRXRIFDROGI-ICWBMWKASA-N |
| XLogP | 1.92 |
| TPSA | 66.91 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 222.27 |
| LogP ≤ 5 | 1.92 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|