C24H26N2O6 — CID 130476112
2,5-bis[(3,4-dimethoxyphenyl)methylamino]cyclohexa-2,5-diene-1,4-dione (PubChem CID 130476112) has the molecular formula C24H26N2O6 and a molecular weight of 438.48 g/mol. Its IUPAC name is 2,5-bis[(3,4-dimethoxyphenyl)methylamino]cyclohexa-2,5-diene-1,4-dione.
| Compound Name | 2,5-bis[(3,4-dimethoxyphenyl)methylamino]cyclohexa-2,5-diene-1,4-dione |
|---|---|
| PubChem CID | 130476112 |
| Molecular Formula | C24H26N2O6 |
| Molecular Weight | 438.48 g/mol |
| Exact Mass | 438.18 |
| IUPAC Name | 2,5-bis[(3,4-dimethoxyphenyl)methylamino]cyclohexa-2,5-diene-1,4-dione |
| SMILES | COc1ccc(CNC2=CC(=O)C(NCc3ccc(OC)c(OC)c3)=CC2=O)cc1OC |
| InChI | InChI=1S/C24H26N2O6/c1-29-21-7-5-15(9-23(21)31-3)13-25-17-11-20(28)18(12-19(17)27)26-14-16-6-8-22(30-2)24(10-16)32-4/h5-12,25-26H,13-14H2,1-4H3 |
| InChIKey | BRXLTOKEEXHOGV-UHFFFAOYSA-N |
| XLogP | 2.52 |
| TPSA | 95.12 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 438.48 |
| LogP ≤ 5 | 2.52 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'}, {'alert_name': 'chinone_1', 'substructure': 'N/A'} |
|---|