C34H32N4O2 — CID 130476113
2,5-bis[4-(4-amino-3-methylphenyl)-2-methylanilino]cyclohexa-2,5-diene-1,4-dione (PubChem CID 130476113) has the molecular formula C34H32N4O2 and a molecular weight of 528.66 g/mol. Its IUPAC name is 2,5-bis[4-(4-amino-3-methylphenyl)-2-methylanilino]cyclohexa-2,5-diene-1,4-dione.
| Compound Name | 2,5-bis[4-(4-amino-3-methylphenyl)-2-methylanilino]cyclohexa-2,5-diene-1,4-dione |
|---|---|
| PubChem CID | 130476113 |
| Molecular Formula | C34H32N4O2 |
| Molecular Weight | 528.66 g/mol |
| Exact Mass | 528.25 |
| IUPAC Name | 2,5-bis[4-(4-amino-3-methylphenyl)-2-methylanilino]cyclohexa-2,5-diene-1,4-dione |
| SMILES | Cc1cc(-c2ccc(NC3=CC(=O)C(Nc4ccc(-c5ccc(N)c(C)c5)cc4C)=CC3=O)c(C)c2)ccc1N |
| InChI | InChI=1S/C34H32N4O2/c1-19-13-23(5-9-27(19)35)25-7-11-29(21(3)15-25)37-31-17-34(40)32(18-33(31)39)38-30-12-8-26(16-22(30)4)24-6-10-28(36)20(2)14-24/h5-18,37-38H,35-36H2,1-4H3 |
| InChIKey | ONUNBTZLISOYRH-UHFFFAOYSA-N |
| XLogP | 6.86 |
| TPSA | 110.24 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 528.66 |
| LogP ≤ 5 | 6.86 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'chinone_1', 'substructure': 'N/A'} |
|---|