C27H35N5O3S — CID 130476250
1-[(5-ethyl-4-oxo-1,2,3,6-tetrahydro-1,5-benzodiazocin-8-yl)methyl]-3-[2-[(2R)-2-(2-methylsulfanylphenyl)pyrrolidin-1-yl]-2-oxoethyl]urea (PubChem CID 130476250) has the molecular formula C27H35N5O3S and a molecular weight of 509.68 g/mol. Its IUPAC name is 1-[(5-ethyl-4-oxo-1,2,3,6-tetrahydro-1,5-benzodiazocin-8-yl)methyl]-3-[2-[(2R)-2-(2-methylsulfanylphenyl)pyrrolidin-1-yl]-2-oxoethyl]urea.
| Compound Name | 1-[(5-ethyl-4-oxo-1,2,3,6-tetrahydro-1,5-benzodiazocin-8-yl)methyl]-3-[2-[(2R)-2-(2-methylsulfanylphenyl)pyrrolidin-1-yl]-2-oxoethyl]urea |
|---|---|
| PubChem CID | 130476250 |
| Molecular Formula | C27H35N5O3S |
| Molecular Weight | 509.68 g/mol |
| Exact Mass | 509.25 |
| IUPAC Name | 1-[(5-ethyl-4-oxo-1,2,3,6-tetrahydro-1,5-benzodiazocin-8-yl)methyl]-3-[2-[(2R)-2-(2-methylsulfanylphenyl)pyrrolidin-1-yl]-2-oxoethyl]urea |
| SMILES | CCN1Cc2cc(CNC(=O)NCC(=O)N3CCC[C@@H]3c3ccccc3SC)ccc2NCCC1=O |
| InChI | InChI=1S/C27H35N5O3S/c1-3-31-18-20-15-19(10-11-22(20)28-13-12-25(31)33)16-29-27(35)30-17-26(34)32-14-6-8-23(32)21-7-4-5-9-24(21)36-2/h4-5,7,9-11,15,23,28H,3,6,8,12-14,16-18H2,1-2H3,(H2,29,30,35)/t23-/m1/s1 |
| InChIKey | KVRLCSQKFNRTCC-HSZRJFAPSA-N |
| XLogP | 3.74 |
| TPSA | 93.78 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 509.68 |
| LogP ≤ 5 | 3.74 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |